About N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide
N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide (PubChem CID 19526453) has the molecular formula C18H20N6O5S
and a molecular weight of 432.46 g/mol. Its IUPAC name is N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide |
| PubChem CID | 19526453 |
| Molecular Formula | C18H20N6O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)Cn3cc(C)cn3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C18H20N6O5S/c1-12-9-19-24(10-12)11-16(25)20-13-4-6-14(7-5-13)30(26,27)23-15-8-17(28-2)22-18(21-15)29-3/h4-10H,11H2,1-3H3,(H,20,25)(H,21,22,23) |
| InChIKey | AHWDCCVKNVVKQM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide?
The IUPAC name of N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide (CID 19526453) is N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide.
What is the SMILES notation for N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide?
The canonical SMILES for N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide is COc1cc(NS(=O)(=O)c2ccc(NC(=O)Cn3cc(C)cn3)cc2)nc(OC)n1.
What is the InChIKey of N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide?
The InChIKey is AHWDCCVKNVVKQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6O5S/c1-12-9-19-24(10-12)11-16(25)20-13-4-6-14(7-5-13)30(26,27)23-15-8-17(28-2)22-18(21-15)29-3/h4-10H,11H2,1-3H3,(H,20,25)(H,21,22,23).
What are the key properties of N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide?
N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide has a molecular weight of 432.46 g/mol, XLogP of 1.44, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-2-(4-methylpyrazol-1-yl)acetamide is sourced from PubChem (CID 19526453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).