C18H24N4O3S — CID 4180072
N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]hexanamide (PubChem CID 4180072) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]hexanamide.
| Compound Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 4180072 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(S(=O)(=O)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-4-5-6-7-17(23)21-15-8-10-16(11-9-15)26(24,25)22-18-19-13(2)12-14(3)20-18/h8-12H,4-7H2,1-3H3,(H,21,23)(H,19,20,22) |
| InChIKey | PHLOKQHHLDLCHY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|