C21H28N2O3S — CID 54790569
N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]heptanamide (PubChem CID 54790569) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]heptanamide.
| Compound Name | N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]heptanamide |
|---|---|
| PubChem CID | 54790569 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-4-5-6-7-8-21(24)22-18-11-13-20(14-12-18)27(25,26)23-19-10-9-16(2)17(3)15-19/h9-15,23H,4-8H2,1-3H3,(H,22,24) |
| InChIKey | ZVKUASAWGRSIIU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|