C21H26N2O6S — CID 17339028
2-methoxyethyl 4-[4-[(3,4-dimethylphenyl)sulfamoyl]anilino]-4-oxobutanoate (PubChem CID 17339028) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-methoxyethyl 4-[4-[(3,4-dimethylphenyl)sulfamoyl]anilino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[4-[(3,4-dimethylphenyl)sulfamoyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17339028 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-methoxyethyl 4-[4-[(3,4-dimethylphenyl)sulfamoyl]anilino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H26N2O6S/c1-15-4-5-18(14-16(15)2)23-30(26,27)19-8-6-17(7-9-19)22-20(24)10-11-21(25)29-13-12-28-3/h4-9,14,23H,10-13H2,1-3H3,(H,22,24) |
| InChIKey | JJFOBMKJPNUFIS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|