C17H21N3O7S — CID 17339082
2-methoxyethyl 4-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-4-oxobutanoate (PubChem CID 17339082) has the molecular formula C17H21N3O7S and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-methoxyethyl 4-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17339082 |
| Molecular Formula | C17H21N3O7S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-methoxyethyl 4-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)Nc1ccc(S(=O)(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C17H21N3O7S/c1-12-11-15(19-27-12)20-28(23,24)14-5-3-13(4-6-14)18-16(21)7-8-17(22)26-10-9-25-2/h3-6,11H,7-10H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | KLRUZWNDVDQMLX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|