C22H26N4O4S2 — CID 19683735
4-butyl-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 19683735) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-butyl-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-butyl-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19683735 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 4-butyl-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3nc(C)cc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C22H26N4O4S2/c1-4-5-6-18-7-11-20(12-8-18)31(27,28)25-19-9-13-21(14-10-19)32(29,30)26-22-23-16(2)15-17(3)24-22/h7-15,25H,4-6H2,1-3H3,(H,23,24,26) |
| InChIKey | CYJRHPOYOICSMQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |