C16H23N4O3PS — CID 134111248
4-(diethylphosphorylamino)-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 134111248) has the molecular formula C16H23N4O3PS and a molecular weight of 382.43 g/mol. Its IUPAC name is 4-(diethylphosphorylamino)-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-(diethylphosphorylamino)-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134111248 |
| Molecular Formula | C16H23N4O3PS |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 4-(diethylphosphorylamino)-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | CCP(=O)(CC)Nc1ccc(S(=O)(=O)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C16H23N4O3PS/c1-5-24(21,6-2)19-14-7-9-15(10-8-14)25(22,23)20-16-17-12(3)11-13(4)18-16/h7-11H,5-6H2,1-4H3,(H,19,21)(H,17,18,20) |
| InChIKey | PRARVYPKTDQKKJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|