C15H22N3O4PS — CID 134087504
4-(diethylphosphorylamino)-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 134087504) has the molecular formula C15H22N3O4PS and a molecular weight of 371.40 g/mol. Its IUPAC name is 4-(diethylphosphorylamino)-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-(diethylphosphorylamino)-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134087504 |
| Molecular Formula | C15H22N3O4PS |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-(diethylphosphorylamino)-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | CCP(=O)(CC)Nc1ccc(S(=O)(=O)Nc2noc(C)c2C)cc1 |
| InChI | InChI=1S/C15H22N3O4PS/c1-5-23(19,6-2)17-13-7-9-14(10-8-13)24(20,21)18-15-11(3)12(4)22-16-15/h7-10H,5-6H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | OPHRPLVMHWNDHU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|