C19H19N5O5S — CID 177378575
N-[3-[[4-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]diazenyl]-4-hydroxyphenyl]acetamide (PubChem CID 177378575) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[3-[[4-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]diazenyl]-4-hydroxyphenyl]acetamide.
| Compound Name | N-[3-[[4-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]diazenyl]-4-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 177378575 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[3-[[4-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]diazenyl]-4-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(O)c(/N=N/c2ccc(S(=O)(=O)Nc3noc(C)c3C)cc2)c1 |
| InChI | InChI=1S/C19H19N5O5S/c1-11-12(2)29-23-19(11)24-30(27,28)16-7-4-14(5-8-16)21-22-17-10-15(20-13(3)25)6-9-18(17)26/h4-10,26H,1-3H3,(H,20,25)(H,23,24)/b22-21+ |
| InChIKey | RQHAAHGGXJWXMZ-QURGRASLSA-N |
| XLogP | 4.17 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|