C18H23N4O2+ — CID 136707795
[2-[4-[(2-hydroxy-5-methylphenyl)diazenyl]anilino]-2-oxoethyl]-trimethylazanium (PubChem CID 136707795) has the molecular formula C18H23N4O2+ and a molecular weight of 327.41 g/mol. Its IUPAC name is [2-[4-[(2-hydroxy-5-methylphenyl)diazenyl]anilino]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[4-[(2-hydroxy-5-methylphenyl)diazenyl]anilino]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 136707795 |
| Molecular Formula | C18H23N4O2+ |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [2-[4-[(2-hydroxy-5-methylphenyl)diazenyl]anilino]-2-oxoethyl]-trimethylazanium |
| SMILES | Cc1ccc(O)c(/N=N/c2ccc(NC(=O)C[N+](C)(C)C)cc2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-13-5-10-17(23)16(11-13)21-20-15-8-6-14(7-9-15)19-18(24)12-22(2,3)4/h5-11H,12H2,1-4H3,(H-,19,20,21,23,24)/p+1 |
| InChIKey | WHAFLHSABXMJDB-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|