About benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol
benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol (PubChem CID 160570750) has the molecular formula C20H20N2O2
and a molecular weight of 320.39 g/mol. Its IUPAC name is benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol.
Molecular Properties
| Compound Name | benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol |
| PubChem CID | 160570750 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(/N=N/c2cc(C)ccc2O)c1.c1ccccc1 |
| InChI | InChI=1S/C14H14N2O2.C6H6/c1-9-3-5-13(17)11(7-9)15-16-12-8-10(2)4-6-14(12)18;1-2-4-6-5-3-1/h3-8,17-18H,1-2H3;1-6H/b16-15+; |
| InChIKey | RANAOXGZXZAEQN-GEEYTBSJSA-N |
| XLogP | 5.82 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol?
The IUPAC name of benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol (CID 160570750) is benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol.
What is the SMILES notation for benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol?
The canonical SMILES for benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol is Cc1ccc(O)c(/N=N/c2cc(C)ccc2O)c1.c1ccccc1.
What is the InChIKey of benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol?
The InChIKey is RANAOXGZXZAEQN-GEEYTBSJSA-N. The full InChI is InChI=1S/C14H14N2O2.C6H6/c1-9-3-5-13(17)11(7-9)15-16-12-8-10(2)4-6-14(12)18;1-2-4-6-5-3-1/h3-8,17-18H,1-2H3;1-6H/b16-15+;.
What are the key properties of benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol?
benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol has a molecular weight of 320.39 g/mol, XLogP of 5.82, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-[(2-hydroxy-5-methylphenyl)diazenyl]-4-methylphenol is sourced from PubChem (CID 160570750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).