C37H36N4O2 — CID 137157437
2-[[3-[[4-[(2-hydroxy-5-methylphenyl)diazenyl]-2,5-dimethylphenyl]-phenylmethyl]-2,5-dimethylphenyl]diazenyl]-4-methylphenol (PubChem CID 137157437) has the molecular formula C37H36N4O2 and a molecular weight of 568.72 g/mol. Its IUPAC name is 2-[[3-[[4-[(2-hydroxy-5-methylphenyl)diazenyl]-2,5-dimethylphenyl]-phenylmethyl]-2,5-dimethylphenyl]diazenyl]-4-methylphenol.
| Compound Name | 2-[[3-[[4-[(2-hydroxy-5-methylphenyl)diazenyl]-2,5-dimethylphenyl]-phenylmethyl]-2,5-dimethylphenyl]diazenyl]-4-methylphenol |
|---|---|
| PubChem CID | 137157437 |
| Molecular Formula | C37H36N4O2 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 2-[[3-[[4-[(2-hydroxy-5-methylphenyl)diazenyl]-2,5-dimethylphenyl]-phenylmethyl]-2,5-dimethylphenyl]diazenyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(/N=N/c2cc(C)c(C(c3ccccc3)c3cc(C)cc(/N=N/c4cc(C)ccc4O)c3C)cc2C)c1 |
| InChI | InChI=1S/C37H36N4O2/c1-22-12-14-35(42)33(17-22)40-38-31-21-25(4)29(20-26(31)5)37(28-10-8-7-9-11-28)30-16-24(3)19-32(27(30)6)39-41-34-18-23(2)13-15-36(34)43/h7-21,37,42-43H,1-6H3/b40-38+,41-39+ |
| InChIKey | FFMHDYNETNTVLH-QYGUTFKISA-N |
| XLogP | 10.96 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|