C26H32O2 — CID 143591911
ethane;2-[(4-hydroxy-2,5-dimethylphenyl)-(3-methylphenyl)methyl]-4,6-dimethylphenol (PubChem CID 143591911) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is ethane;2-[(4-hydroxy-2,5-dimethylphenyl)-(3-methylphenyl)methyl]-4,6-dimethylphenol.
| Compound Name | ethane;2-[(4-hydroxy-2,5-dimethylphenyl)-(3-methylphenyl)methyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 143591911 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | ethane;2-[(4-hydroxy-2,5-dimethylphenyl)-(3-methylphenyl)methyl]-4,6-dimethylphenol |
| SMILES | CC.Cc1cccc(C(c2cc(C)c(O)cc2C)c2cc(C)cc(C)c2O)c1 |
| InChI | InChI=1S/C24H26O2.C2H6/c1-14-7-6-8-19(10-14)23(20-12-17(4)22(25)13-16(20)3)21-11-15(2)9-18(5)24(21)26;1-2/h6-13,23,25-26H,1-5H3;1-2H3 |
| InChIKey | JHPJWNIOXVRNAV-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|