C37H36O5 — CID 86179554
2,6-bis[bis(4-hydroxy-3-methylphenyl)methyl]-4-methylphenol (PubChem CID 86179554) has the molecular formula C37H36O5 and a molecular weight of 560.69 g/mol. Its IUPAC name is 2,6-bis[bis(4-hydroxy-3-methylphenyl)methyl]-4-methylphenol.
| Compound Name | 2,6-bis[bis(4-hydroxy-3-methylphenyl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 86179554 |
| Molecular Formula | C37H36O5 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 2,6-bis[bis(4-hydroxy-3-methylphenyl)methyl]-4-methylphenol |
| SMILES | Cc1cc(C(c2ccc(O)c(C)c2)c2ccc(O)c(C)c2)c(O)c(C(c2ccc(O)c(C)c2)c2ccc(O)c(C)c2)c1 |
| InChI | InChI=1S/C37H36O5/c1-20-14-29(35(25-6-10-31(38)21(2)16-25)26-7-11-32(39)22(3)17-26)37(42)30(15-20)36(27-8-12-33(40)23(4)18-27)28-9-13-34(41)24(5)19-28/h6-19,35-36,38-42H,1-5H3 |
| InChIKey | QIKRQPUDTNFFEQ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|