C34H30O4 — CID 68635784
4-[[4-[(4-hydroxy-3-methylphenyl)-(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxyphenyl)methyl]-2-methylphenol (PubChem CID 68635784) has the molecular formula C34H30O4 and a molecular weight of 502.61 g/mol. Its IUPAC name is 4-[[4-[(4-hydroxy-3-methylphenyl)-(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxyphenyl)methyl]-2-methylphenol.
| Compound Name | 4-[[4-[(4-hydroxy-3-methylphenyl)-(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxyphenyl)methyl]-2-methylphenol |
|---|---|
| PubChem CID | 68635784 |
| Molecular Formula | C34H30O4 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 4-[[4-[(4-hydroxy-3-methylphenyl)-(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxyphenyl)methyl]-2-methylphenol |
| SMILES | Cc1cc(C(c2ccc(O)cc2)c2ccc(C(c3ccc(O)cc3)c3ccc(O)c(C)c3)cc2)ccc1O |
| InChI | InChI=1S/C34H30O4/c1-21-19-27(11-17-31(21)37)33(25-7-13-29(35)14-8-25)23-3-5-24(6-4-23)34(26-9-15-30(36)16-10-26)28-12-18-32(38)22(2)20-28/h3-20,33-38H,1-2H3 |
| InChIKey | ARXSPNNYPOCYQL-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|