C21H20O4 — CID 155000449
4-[(5-hydroxy-2-methylphenyl)-(4-hydroxyphenyl)methyl]-5-methylbenzene-1,2-diol (PubChem CID 155000449) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[(5-hydroxy-2-methylphenyl)-(4-hydroxyphenyl)methyl]-5-methylbenzene-1,2-diol.
| Compound Name | 4-[(5-hydroxy-2-methylphenyl)-(4-hydroxyphenyl)methyl]-5-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 155000449 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[(5-hydroxy-2-methylphenyl)-(4-hydroxyphenyl)methyl]-5-methylbenzene-1,2-diol |
| SMILES | Cc1ccc(O)cc1C(c1ccc(O)cc1)c1cc(O)c(O)cc1C |
| InChI | InChI=1S/C21H20O4/c1-12-3-6-16(23)10-17(12)21(14-4-7-15(22)8-5-14)18-11-20(25)19(24)9-13(18)2/h3-11,21-25H,1-2H3 |
| InChIKey | MENSDRZNXARKJB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|