C19H16O4 — CID 23019022
2-[(2,5-dihydroxyphenyl)-phenylmethyl]benzene-1,4-diol (PubChem CID 23019022) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[(2,5-dihydroxyphenyl)-phenylmethyl]benzene-1,4-diol.
| Compound Name | 2-[(2,5-dihydroxyphenyl)-phenylmethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 23019022 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[(2,5-dihydroxyphenyl)-phenylmethyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(C(c2ccccc2)c2cc(O)ccc2O)c1 |
| InChI | InChI=1S/C19H16O4/c20-13-6-8-17(22)15(10-13)19(12-4-2-1-3-5-12)16-11-14(21)7-9-18(16)23/h1-11,19-23H |
| InChIKey | NLOUMBZVDCITCW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|