C28H28O4 — CID 139072584
4-[(1R)-1-phenylethyl]benzene-1,3-diol (PubChem CID 139072584) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-[(1R)-1-phenylethyl]benzene-1,3-diol.
| Compound Name | 4-[(1R)-1-phenylethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 139072584 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 4-[(1R)-1-phenylethyl]benzene-1,3-diol |
| SMILES | C[C@H](c1ccccc1)c1ccc(O)cc1O.C[C@H](c1ccccc1)c1ccc(O)cc1O |
| InChI | InChI=1S/2C14H14O2/c2*1-10(11-5-3-2-4-6-11)13-8-7-12(15)9-14(13)16/h2*2-10,15-16H,1H3/t2*10-/m11/s1 |
| InChIKey | PNFREFQPTIOHRO-IMUCLEIGSA-N |
| XLogP | 6.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |