C15H14O3 — CID 13035012
6-(1-phenylethyl)-1,3-benzodioxol-5-ol (PubChem CID 13035012) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 6-(1-phenylethyl)-1,3-benzodioxol-5-ol.
| Compound Name | 6-(1-phenylethyl)-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 13035012 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 6-(1-phenylethyl)-1,3-benzodioxol-5-ol |
| SMILES | CC(c1ccccc1)c1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C15H14O3/c1-10(11-5-3-2-4-6-11)12-7-14-15(8-13(12)16)18-9-17-14/h2-8,10,16H,9H2,1H3 |
| InChIKey | BWAVINRZBCEJBE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |