C44H42O2 — CID 70559392
4-[4-hydroxy-2,6-bis(1-phenylethyl)phenyl]-3,5-bis(1-phenylethyl)phenol (PubChem CID 70559392) has the molecular formula C44H42O2 and a molecular weight of 602.82 g/mol. Its IUPAC name is 4-[4-hydroxy-2,6-bis(1-phenylethyl)phenyl]-3,5-bis(1-phenylethyl)phenol.
| Compound Name | 4-[4-hydroxy-2,6-bis(1-phenylethyl)phenyl]-3,5-bis(1-phenylethyl)phenol |
|---|---|
| PubChem CID | 70559392 |
| Molecular Formula | C44H42O2 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 4-[4-hydroxy-2,6-bis(1-phenylethyl)phenyl]-3,5-bis(1-phenylethyl)phenol |
| SMILES | CC(c1ccccc1)c1cc(O)cc(C(C)c2ccccc2)c1-c1c(C(C)c2ccccc2)cc(O)cc1C(C)c1ccccc1 |
| InChI | InChI=1S/C44H42O2/c1-29(33-17-9-5-10-18-33)39-25-37(45)26-40(30(2)34-19-11-6-12-20-34)43(39)44-41(31(3)35-21-13-7-14-22-35)27-38(46)28-42(44)32(4)36-23-15-8-16-24-36/h5-32,45-46H,1-4H3 |
| InChIKey | PKGNYVJUBXNNPM-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |