C19H24O — CID 1271819
2-tert-butyl-4-methyl-6-[(1R)-1-phenylethyl]phenol (PubChem CID 1271819) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[(1R)-1-phenylethyl]phenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[(1R)-1-phenylethyl]phenol |
|---|---|
| PubChem CID | 1271819 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[(1R)-1-phenylethyl]phenol |
| SMILES | Cc1cc([C@H](C)c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H24O/c1-13-11-16(14(2)15-9-7-6-8-10-15)18(20)17(12-13)19(3,4)5/h6-12,14,20H,1-5H3/t14-/m1/s1 |
| InChIKey | KYWXWCOPNNMDMN-CQSZACIVSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |