C21H26OS — CID 15139972
2-cyclohexylsulfanyl-4-methyl-6-(1-phenylethyl)phenol (PubChem CID 15139972) has the molecular formula C21H26OS and a molecular weight of 326.51 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-4-methyl-6-(1-phenylethyl)phenol.
| Compound Name | 2-cyclohexylsulfanyl-4-methyl-6-(1-phenylethyl)phenol |
|---|---|
| PubChem CID | 15139972 |
| Molecular Formula | C21H26OS |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-cyclohexylsulfanyl-4-methyl-6-(1-phenylethyl)phenol |
| SMILES | Cc1cc(SC2CCCCC2)c(O)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C21H26OS/c1-15-13-19(16(2)17-9-5-3-6-10-17)21(22)20(14-15)23-18-11-7-4-8-12-18/h3,5-6,9-10,13-14,16,18,22H,4,7-8,11-12H2,1-2H3 |
| InChIKey | GJQDEBCKKGITMZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |