C48H48N2 — CID 11331952
N,N'-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]ethane-1,2-diimine (PubChem CID 11331952) has the molecular formula C48H48N2 and a molecular weight of 652.93 g/mol. Its IUPAC name is N,N'-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]ethane-1,2-diimine.
| Compound Name | N,N'-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 11331952 |
| Molecular Formula | C48H48N2 |
| Molecular Weight | 652.93 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | N,N'-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]ethane-1,2-diimine |
| SMILES | Cc1cc([C@@H](C)c2ccccc2)c(/N=C/C=N/c2c([C@@H](C)c3ccccc3)cc(C)cc2[C@@H](C)c2ccccc2)c([C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C48H48N2/c1-33-29-43(35(3)39-19-11-7-12-20-39)47(44(30-33)36(4)40-21-13-8-14-22-40)49-27-28-50-48-45(37(5)41-23-15-9-16-24-41)31-34(2)32-46(48)38(6)42-25-17-10-18-26-42/h7-32,35-38H,1-6H3/b49-27+,50-28+/t35-,36-,37-,38-/m0/s1 |
| InChIKey | JAMNINDRPHCIDB-RNGAGJSKSA-N |
| XLogP | 13.02 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.93 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|