C26H36CoN2 — CID 69498606
N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;cobalt (PubChem CID 69498606) has the molecular formula C26H36CoN2 and a molecular weight of 435.52 g/mol. Its IUPAC name is N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;cobalt.
| Compound Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;cobalt |
|---|---|
| PubChem CID | 69498606 |
| Molecular Formula | C26H36CoN2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;cobalt |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/C=N/c1c(C(C)C)cccc1C(C)C.[Co] |
| InChI | InChI=1S/C26H36N2.Co/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8;/h9-20H,1-8H3;/b27-15+,28-16+; |
| InChIKey | HYQPJIPVCNYNPE-FRYFQGJDSA-N |
| XLogP | 8.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|