C26H36Br2N2Ni — CID 21339155
N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;dibromonickel (PubChem CID 21339155) has the molecular formula C26H36Br2N2Ni and a molecular weight of 595.09 g/mol. Its IUPAC name is N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;dibromonickel.
| Compound Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;dibromonickel |
|---|---|
| PubChem CID | 21339155 |
| Molecular Formula | C26H36Br2N2Ni |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 592.06 |
| IUPAC Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;dibromonickel |
| SMILES | Br[Ni]Br.CC(C)c1cccc(C(C)C)c1/N=C/C=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C26H36N2.2BrH.Ni/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8;;;/h9-20H,1-8H3;2*1H;/q;;;+2/p-2/b27-15+,28-16+;;; |
| InChIKey | WBQLICPIMKTKKK-VEDJOPRVSA-L |
| XLogP | 9.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|