C32H40N2 — CID 2755070
N-[2,6-di(propan-2-yl)phenyl]-1-[4-[[2,6-di(propan-2-yl)phenyl]iminomethyl]phenyl]methanimine (PubChem CID 2755070) has the molecular formula C32H40N2 and a molecular weight of 452.69 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1-[4-[[2,6-di(propan-2-yl)phenyl]iminomethyl]phenyl]methanimine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1-[4-[[2,6-di(propan-2-yl)phenyl]iminomethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 2755070 |
| Molecular Formula | C32H40N2 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1-[4-[[2,6-di(propan-2-yl)phenyl]iminomethyl]phenyl]methanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1ccc(/C=N/c2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C32H40N2/c1-21(2)27-11-9-12-28(22(3)4)31(27)33-19-25-15-17-26(18-16-25)20-34-32-29(23(5)6)13-10-14-30(32)24(7)8/h9-24H,1-8H3/b33-19+,34-20+ |
| InChIKey | DZPMXXSRJPFJID-ZXHXELASSA-N |
| XLogP | 9.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|