C20H28FeN2 — CID 147504192
carbanide;N-[2,6-di(propan-2-yl)phenyl]-1-pyridin-2-ylmethanimine;iron(2+) (PubChem CID 147504192) has the molecular formula C20H28FeN2 and a molecular weight of 352.30 g/mol. Its IUPAC name is carbanide;N-[2,6-di(propan-2-yl)phenyl]-1-pyridin-2-ylmethanimine;iron(2+).
| Compound Name | carbanide;N-[2,6-di(propan-2-yl)phenyl]-1-pyridin-2-ylmethanimine;iron(2+) |
|---|---|
| PubChem CID | 147504192 |
| Molecular Formula | C20H28FeN2 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | carbanide;N-[2,6-di(propan-2-yl)phenyl]-1-pyridin-2-ylmethanimine;iron(2+) |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1ccccn1.[CH3-].[CH3-].[Fe+2] |
| InChI | InChI=1S/C18H22N2.2CH3.Fe/c1-13(2)16-9-7-10-17(14(3)4)18(16)20-12-15-8-5-6-11-19-15;;;/h5-14H,1-4H3;2*1H3;/q;2*-1;+2/b20-12+;;; |
| InChIKey | MUYPOLVPOAZJIO-TXBTUDEPSA-N |
| XLogP | 5.98 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|