C43H48N4O — CID 69491874
3,5-bis[3,5-di(propan-2-yl)-4-(pyridin-2-ylmethylideneamino)phenyl]-4-methylphenol (PubChem CID 69491874) has the molecular formula C43H48N4O and a molecular weight of 636.88 g/mol. Its IUPAC name is 3,5-bis[3,5-di(propan-2-yl)-4-(pyridin-2-ylmethylideneamino)phenyl]-4-methylphenol.
| Compound Name | 3,5-bis[3,5-di(propan-2-yl)-4-(pyridin-2-ylmethylideneamino)phenyl]-4-methylphenol |
|---|---|
| PubChem CID | 69491874 |
| Molecular Formula | C43H48N4O |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.38 |
| IUPAC Name | 3,5-bis[3,5-di(propan-2-yl)-4-(pyridin-2-ylmethylideneamino)phenyl]-4-methylphenol |
| SMILES | Cc1c(-c2cc(C(C)C)c(/N=C/c3ccccn3)c(C(C)C)c2)cc(O)cc1-c1cc(C(C)C)c(/N=C/c2ccccn2)c(C(C)C)c1 |
| InChI | InChI=1S/C43H48N4O/c1-26(2)36-18-31(19-37(27(3)4)42(36)46-24-33-14-10-12-16-44-33)40-22-35(48)23-41(30(40)9)32-20-38(28(5)6)43(39(21-32)29(7)8)47-25-34-15-11-13-17-45-34/h10-29,48H,1-9H3/b46-24+,47-25+ |
| InChIKey | HIXVHTCIFGEDMF-LJFCGWSJSA-N |
| XLogP | 11.82 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|