C38H44N2O2 — CID 135431783
2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-[3-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-2-hydroxyphenyl]phenol (PubChem CID 135431783) has the molecular formula C38H44N2O2 and a molecular weight of 560.78 g/mol. Its IUPAC name is 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-[3-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-2-hydroxyphenyl]phenol.
| Compound Name | 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-[3-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-2-hydroxyphenyl]phenol |
|---|---|
| PubChem CID | 135431783 |
| Molecular Formula | C38H44N2O2 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-[3-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-2-hydroxyphenyl]phenol |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1cccc(-c2cccc(/C=N/c3c(C(C)C)cccc3C(C)C)c2O)c1O |
| InChI | InChI=1S/C38H44N2O2/c1-23(2)29-15-11-16-30(24(3)4)35(29)39-21-27-13-9-19-33(37(27)41)34-20-10-14-28(38(34)42)22-40-36-31(25(5)6)17-12-18-32(36)26(7)8/h9-26,41-42H,1-8H3/b39-21+,40-22+ |
| InChIKey | BEZQCGOZLQUYEY-NJHHXWHYSA-N |
| XLogP | 10.76 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|