C20H24ClNO2 — CID 136669440
4-chloro-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-methoxyphenol (PubChem CID 136669440) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is 4-chloro-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-methoxyphenol.
| Compound Name | 4-chloro-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 136669440 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-chloro-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(Cl)cc(/C=N/c2c(C(C)C)cccc2C(C)C)c1O |
| InChI | InChI=1S/C20H24ClNO2/c1-12(2)16-7-6-8-17(13(3)4)19(16)22-11-14-9-15(21)10-18(24-5)20(14)23/h6-13,23H,1-5H3/b22-11+ |
| InChIKey | OWXDVXUVJVIZBV-SSDVNMTOSA-N |
| XLogP | 6.05 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|