C36H41NO2 — CID 136747675
4-tert-butyl-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-[hydroxy(diphenyl)methyl]phenol (PubChem CID 136747675) has the molecular formula C36H41NO2 and a molecular weight of 519.73 g/mol. Its IUPAC name is 4-tert-butyl-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-[hydroxy(diphenyl)methyl]phenol.
| Compound Name | 4-tert-butyl-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-[hydroxy(diphenyl)methyl]phenol |
|---|---|
| PubChem CID | 136747675 |
| Molecular Formula | C36H41NO2 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | 4-tert-butyl-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-[hydroxy(diphenyl)methyl]phenol |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1cc(C(C)(C)C)cc(C(O)(c2ccccc2)c2ccccc2)c1O |
| InChI | InChI=1S/C36H41NO2/c1-24(2)30-19-14-20-31(25(3)4)33(30)37-23-26-21-29(35(5,6)7)22-32(34(26)38)36(39,27-15-10-8-11-16-27)28-17-12-9-13-18-28/h8-25,38-39H,1-7H3/b37-23+ |
| InChIKey | BZRUVOAQFIJEOM-GUBAARJWSA-N |
| XLogP | 8.97 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|