C46H46O4 — CID 122373316
4-tert-butyl-2-[5-tert-butyl-2-hydroxy-3-[hydroxy(diphenyl)methyl]phenyl]-6-[hydroxy(diphenyl)methyl]phenol (PubChem CID 122373316) has the molecular formula C46H46O4 and a molecular weight of 662.87 g/mol. Its IUPAC name is 4-tert-butyl-2-[5-tert-butyl-2-hydroxy-3-[hydroxy(diphenyl)methyl]phenyl]-6-[hydroxy(diphenyl)methyl]phenol.
| Compound Name | 4-tert-butyl-2-[5-tert-butyl-2-hydroxy-3-[hydroxy(diphenyl)methyl]phenyl]-6-[hydroxy(diphenyl)methyl]phenol |
|---|---|
| PubChem CID | 122373316 |
| Molecular Formula | C46H46O4 |
| Molecular Weight | 662.87 g/mol |
| Exact Mass | 662.34 |
| IUPAC Name | 4-tert-butyl-2-[5-tert-butyl-2-hydroxy-3-[hydroxy(diphenyl)methyl]phenyl]-6-[hydroxy(diphenyl)methyl]phenol |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(O)(c3ccccc3)c3ccccc3)c2O)c(O)c(C(O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C46H46O4/c1-43(2,3)35-27-37(41(47)39(29-35)45(49,31-19-11-7-12-20-31)32-21-13-8-14-22-32)38-28-36(44(4,5)6)30-40(42(38)48)46(50,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-30,47-50H,1-6H3 |
| InChIKey | RCMXTKMSQPRFJS-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.87 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|