C23H26O3 — CID 10405622
3-(3,5-ditert-butyl-2-hydroxyphenyl)chromen-2-one (PubChem CID 10405622) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-2-hydroxyphenyl)chromen-2-one.
| Compound Name | 3-(3,5-ditert-butyl-2-hydroxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 10405622 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 3-(3,5-ditert-butyl-2-hydroxyphenyl)chromen-2-one |
| SMILES | CC(C)(C)c1cc(-c2cc3ccccc3oc2=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H26O3/c1-22(2,3)15-12-16(20(24)18(13-15)23(4,5)6)17-11-14-9-7-8-10-19(14)26-21(17)25/h7-13,24H,1-6H3 |
| InChIKey | PGJROOVOXFRAII-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|