C23H26O2 — CID 26967072
6,8-ditert-butyl-3-phenylchromen-2-one (PubChem CID 26967072) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 6,8-ditert-butyl-3-phenylchromen-2-one.
| Compound Name | 6,8-ditert-butyl-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 26967072 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 6,8-ditert-butyl-3-phenylchromen-2-one |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(=O)c(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C23H26O2/c1-22(2,3)17-12-16-13-18(15-10-8-7-9-11-15)21(24)25-20(16)19(14-17)23(4,5)6/h7-14H,1-6H3 |
| InChIKey | COTMKLHVBITMAZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|