C20H26OTi — CID 175919247
2,4-ditert-butyl-6-phenylphenol;titanium (PubChem CID 175919247) has the molecular formula C20H26OTi and a molecular weight of 330.29 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-phenylphenol;titanium.
| Compound Name | 2,4-ditert-butyl-6-phenylphenol;titanium |
|---|---|
| PubChem CID | 175919247 |
| Molecular Formula | C20H26OTi |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2,4-ditert-butyl-6-phenylphenol;titanium |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(O)c(C(C)(C)C)c1.[Ti] |
| InChI | InChI=1S/C20H26O.Ti/c1-19(2,3)15-12-16(14-10-8-7-9-11-14)18(21)17(13-15)20(4,5)6;/h7-13,21H,1-6H3; |
| InChIKey | YHTJAFDGVCFARD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |