C21H28 — CID 171424873
1,5-ditert-butyl-2-methyl-3-phenylbenzene (PubChem CID 171424873) has the molecular formula C21H28 and a molecular weight of 280.45 g/mol. Its IUPAC name is 1,5-ditert-butyl-2-methyl-3-phenylbenzene.
| Compound Name | 1,5-ditert-butyl-2-methyl-3-phenylbenzene |
|---|---|
| PubChem CID | 171424873 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1,5-ditert-butyl-2-methyl-3-phenylbenzene |
| SMILES | Cc1c(-c2ccccc2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C21H28/c1-15-18(16-11-9-8-10-12-16)13-17(20(2,3)4)14-19(15)21(5,6)7/h8-14H,1-7H3 |
| InChIKey | JFGSEKAZDCEPJH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |