C31H36N+ — CID 155638811
1-(3,5-ditert-butyl-2-methylphenyl)-2-methyl-6-phenylisoquinolin-2-ium (PubChem CID 155638811) has the molecular formula C31H36N+ and a molecular weight of 422.64 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-2-methylphenyl)-2-methyl-6-phenylisoquinolin-2-ium.
| Compound Name | 1-(3,5-ditert-butyl-2-methylphenyl)-2-methyl-6-phenylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155638811 |
| Molecular Formula | C31H36N+ |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 1-(3,5-ditert-butyl-2-methylphenyl)-2-methyl-6-phenylisoquinolin-2-ium |
| SMILES | Cc1c(-c2c3ccc(-c4ccccc4)cc3cc[n+]2C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C31H36N/c1-21-27(19-25(30(2,3)4)20-28(21)31(5,6)7)29-26-15-14-23(22-12-10-9-11-13-22)18-24(26)16-17-32(29)8/h9-20H,1-8H3/q+1 |
| InChIKey | JQVGYOVMMKQVQD-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|