C31H36N+ — CID 166054849
1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-(4-propan-2-ylphenyl)isoquinolin-2-ium (PubChem CID 166054849) has the molecular formula C31H36N+ and a molecular weight of 422.64 g/mol. Its IUPAC name is 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-(4-propan-2-ylphenyl)isoquinolin-2-ium.
| Compound Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-(4-propan-2-ylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 166054849 |
| Molecular Formula | C31H36N+ |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-(4-propan-2-ylphenyl)isoquinolin-2-ium |
| SMILES | Cc1cc(C(C)(C)C)cc(-c2c3ccc(-c4ccc(C(C)C)cc4)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C31H36N/c1-20(2)23-9-11-24(12-10-23)25-13-14-28-26(18-25)15-16-32(8)30(28)29-19-27(31(5,6)7)17-21(3)22(29)4/h9-20H,1-8H3/q+1 |
| InChIKey | OOWKUHPSDXZRSX-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|