C28H40NSi+ — CID 155637876
[1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methylisoquinolin-2-ium-6-yl]-(2,2-dimethylpropyl)-dimethylsilane (PubChem CID 155637876) has the molecular formula C28H40NSi+ and a molecular weight of 418.72 g/mol. Its IUPAC name is [1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methylisoquinolin-2-ium-6-yl]-(2,2-dimethylpropyl)-dimethylsilane.
| Compound Name | [1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methylisoquinolin-2-ium-6-yl]-(2,2-dimethylpropyl)-dimethylsilane |
|---|---|
| PubChem CID | 155637876 |
| Molecular Formula | C28H40NSi+ |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | [1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methylisoquinolin-2-ium-6-yl]-(2,2-dimethylpropyl)-dimethylsilane |
| SMILES | Cc1cc(C(C)C)cc(-c2c3ccc([Si](C)(C)CC(C)(C)C)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C28H40NSi/c1-19(2)23-15-20(3)21(4)26(17-23)27-25-12-11-24(16-22(25)13-14-29(27)8)30(9,10)18-28(5,6)7/h11-17,19H,18H2,1-10H3/q+1 |
| InChIKey | HNBJXDHVHUOXPE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|