C25H31F3NSi+ — CID 176592494
dimethyl-[2-methyl-1-[2,3,5-trimethyl-4-(trifluoromethyl)phenyl]isoquinolin-2-ium-6-yl]-propan-2-ylsilane (PubChem CID 176592494) has the molecular formula C25H31F3NSi+ and a molecular weight of 430.61 g/mol. Its IUPAC name is dimethyl-[2-methyl-1-[2,3,5-trimethyl-4-(trifluoromethyl)phenyl]isoquinolin-2-ium-6-yl]-propan-2-ylsilane.
| Compound Name | dimethyl-[2-methyl-1-[2,3,5-trimethyl-4-(trifluoromethyl)phenyl]isoquinolin-2-ium-6-yl]-propan-2-ylsilane |
|---|---|
| PubChem CID | 176592494 |
| Molecular Formula | C25H31F3NSi+ |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | dimethyl-[2-methyl-1-[2,3,5-trimethyl-4-(trifluoromethyl)phenyl]isoquinolin-2-ium-6-yl]-propan-2-ylsilane |
| SMILES | Cc1cc(-c2c3ccc([Si](C)(C)C(C)C)cc3cc[n+]2C)c(C)c(C)c1C(F)(F)F |
| InChI | InChI=1S/C25H31F3NSi/c1-15(2)30(7,8)20-9-10-21-19(14-20)11-12-29(6)24(21)22-13-16(3)23(25(26,27)28)18(5)17(22)4/h9-15H,1-8H3/q+1 |
| InChIKey | WKAGHJNBULQARS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|