C33H42NSi+ — CID 155637953
[1-(2,3-dimethyl-5-phenylphenyl)-2-methylisoquinolin-2-ium-6-yl]-tri(propan-2-yl)silane (PubChem CID 155637953) has the molecular formula C33H42NSi+ and a molecular weight of 480.79 g/mol. Its IUPAC name is [1-(2,3-dimethyl-5-phenylphenyl)-2-methylisoquinolin-2-ium-6-yl]-tri(propan-2-yl)silane.
| Compound Name | [1-(2,3-dimethyl-5-phenylphenyl)-2-methylisoquinolin-2-ium-6-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 155637953 |
| Molecular Formula | C33H42NSi+ |
| Molecular Weight | 480.79 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | [1-(2,3-dimethyl-5-phenylphenyl)-2-methylisoquinolin-2-ium-6-yl]-tri(propan-2-yl)silane |
| SMILES | Cc1cc(-c2ccccc2)cc(-c2c3ccc([Si](C(C)C)(C(C)C)C(C)C)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C33H42NSi/c1-22(2)35(23(3)4,24(5)6)30-15-16-31-28(20-30)17-18-34(9)33(31)32-21-29(19-25(7)26(32)8)27-13-11-10-12-14-27/h10-24H,1-9H3/q+1 |
| InChIKey | JTLOGZAJBUVNLF-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.79 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|