C36H38NSi+ — CID 155638011
[1-(3-cyclopentyl-2-methyl-5-phenylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane (PubChem CID 155638011) has the molecular formula C36H38NSi+ and a molecular weight of 512.79 g/mol. Its IUPAC name is [1-(3-cyclopentyl-2-methyl-5-phenylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane.
| Compound Name | [1-(3-cyclopentyl-2-methyl-5-phenylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 155638011 |
| Molecular Formula | C36H38NSi+ |
| Molecular Weight | 512.79 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | [1-(3-cyclopentyl-2-methyl-5-phenylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
| SMILES | Cc1c(-c2c3ccc([Si](C)(C)c4ccccc4)cc3cc[n+]2C)cc(-c2ccccc2)cc1C1CCCC1 |
| InChI | InChI=1S/C36H38NSi/c1-26-34(28-15-11-12-16-28)24-30(27-13-7-5-8-14-27)25-35(26)36-33-20-19-32(23-29(33)21-22-37(36)2)38(3,4)31-17-9-6-10-18-31/h5-10,13-14,17-25,28H,11-12,15-16H2,1-4H3/q+1 |
| InChIKey | SOXKVRBSNSJZMI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.79 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|