C35H42NSi+ — CID 157157752
[3,4-dideuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane (PubChem CID 157157752) has the molecular formula C35H42NSi+ and a molecular weight of 506.83 g/mol. Its IUPAC name is [3,4-dideuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane.
| Compound Name | [3,4-dideuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 157157752 |
| Molecular Formula | C35H42NSi+ |
| Molecular Weight | 506.83 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | [3,4-dideuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(C3CCCC3)cc(C3CCCC3)c2C)c2ccc([Si](C)(C)c3ccccc3)cc12 |
| InChI | InChI=1S/C35H42NSi/c1-25-33(27-14-10-11-15-27)23-29(26-12-8-9-13-26)24-34(25)35-32-19-18-31(22-28(32)20-21-36(35)2)37(3,4)30-16-6-5-7-17-30/h5-7,16-24,26-27H,8-15H2,1-4H3/q+1/i20D,21D |
| InChIKey | QRKPKTAAISFTLV-UOGXKHCZSA-N |
| XLogP | 7.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.83 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|