C33H44N+ — CID 160957795
3,4-dideuterio-1-(3,5-dicyclohexyl-2-methylphenyl)-2-methyl-6-(2-methylpropyl)isoquinolin-2-ium (PubChem CID 160957795) has the molecular formula C33H44N+ and a molecular weight of 456.73 g/mol. Its IUPAC name is 3,4-dideuterio-1-(3,5-dicyclohexyl-2-methylphenyl)-2-methyl-6-(2-methylpropyl)isoquinolin-2-ium.
| Compound Name | 3,4-dideuterio-1-(3,5-dicyclohexyl-2-methylphenyl)-2-methyl-6-(2-methylpropyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 160957795 |
| Molecular Formula | C33H44N+ |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 3,4-dideuterio-1-(3,5-dicyclohexyl-2-methylphenyl)-2-methyl-6-(2-methylpropyl)isoquinolin-2-ium |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(C3CCCCC3)cc(C3CCCCC3)c2C)c2ccc(CC(C)C)cc12 |
| InChI | InChI=1S/C33H44N/c1-23(2)19-25-15-16-30-28(20-25)17-18-34(4)33(30)32-22-29(26-11-7-5-8-12-26)21-31(24(32)3)27-13-9-6-10-14-27/h15-18,20-23,26-27H,5-14,19H2,1-4H3/q+1/i17D,18D |
| InChIKey | KYTHTKIRLXNVMV-IUKNHUCNSA-N |
| XLogP | 8.93 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|