C29H38N+ — CID 160957793
1-(5-cyclohexyl-2,3-dimethylphenyl)-4-deuterio-2,3-dimethyl-6-(2-methylpropyl)isoquinolin-2-ium (PubChem CID 160957793) has the molecular formula C29H38N+ and a molecular weight of 401.64 g/mol. Its IUPAC name is 1-(5-cyclohexyl-2,3-dimethylphenyl)-4-deuterio-2,3-dimethyl-6-(2-methylpropyl)isoquinolin-2-ium.
| Compound Name | 1-(5-cyclohexyl-2,3-dimethylphenyl)-4-deuterio-2,3-dimethyl-6-(2-methylpropyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 160957793 |
| Molecular Formula | C29H38N+ |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | 1-(5-cyclohexyl-2,3-dimethylphenyl)-4-deuterio-2,3-dimethyl-6-(2-methylpropyl)isoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C3CCCCC3)cc(C)c2C)c2ccc(CC(C)C)cc12 |
| InChI | InChI=1S/C29H38N/c1-19(2)14-23-12-13-27-26(17-23)16-21(4)30(6)29(27)28-18-25(15-20(3)22(28)5)24-10-8-7-9-11-24/h12-13,15-19,24H,7-11,14H2,1-6H3/q+1/i16D |
| InChIKey | XMIKSDRJCMMPNK-QNLPYAOMSA-N |
| XLogP | 7.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|