C32H38NSi+ — CID 162077271
[1-(5-cyclopentyl-2,3-dimethylphenyl)-2,3-dimethylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane (PubChem CID 162077271) has the molecular formula C32H38NSi+ and a molecular weight of 464.75 g/mol. Its IUPAC name is [1-(5-cyclopentyl-2,3-dimethylphenyl)-2,3-dimethylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane.
| Compound Name | [1-(5-cyclopentyl-2,3-dimethylphenyl)-2,3-dimethylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 162077271 |
| Molecular Formula | C32H38NSi+ |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [1-(5-cyclopentyl-2,3-dimethylphenyl)-2,3-dimethylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
| SMILES | Cc1cc(C2CCCC2)cc(-c2c3ccc([Si](C)(C)c4ccccc4)cc3cc(C)[n+]2C)c1C |
| InChI | InChI=1S/C32H38NSi/c1-22-18-26(25-12-10-11-13-25)21-31(24(22)3)32-30-17-16-29(20-27(30)19-23(2)33(32)4)34(5,6)28-14-8-7-9-15-28/h7-9,14-21,25H,10-13H2,1-6H3/q+1 |
| InChIKey | JGDJOPCDGFBVPW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|