C29H38N+ — CID 160512883
1-(5-cyclopentyl-2,3-dimethylphenyl)-2,3-dimethyl-6-pentan-3-ylisoquinolin-2-ium (PubChem CID 160512883) has the molecular formula C29H38N+ and a molecular weight of 400.63 g/mol. Its IUPAC name is 1-(5-cyclopentyl-2,3-dimethylphenyl)-2,3-dimethyl-6-pentan-3-ylisoquinolin-2-ium.
| Compound Name | 1-(5-cyclopentyl-2,3-dimethylphenyl)-2,3-dimethyl-6-pentan-3-ylisoquinolin-2-ium |
|---|---|
| PubChem CID | 160512883 |
| Molecular Formula | C29H38N+ |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 1-(5-cyclopentyl-2,3-dimethylphenyl)-2,3-dimethyl-6-pentan-3-ylisoquinolin-2-ium |
| SMILES | CCC(CC)c1ccc2c(-c3cc(C4CCCC4)cc(C)c3C)[n+](C)c(C)cc2c1 |
| InChI | InChI=1S/C29H38N/c1-7-22(8-2)24-13-14-27-26(17-24)16-20(4)30(6)29(27)28-18-25(15-19(3)21(28)5)23-11-9-10-12-23/h13-18,22-23H,7-12H2,1-6H3/q+1 |
| InChIKey | CYKGZLNEEZGEEG-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|