C28H30N+ — CID 159812092
4-(5-cyclopentyl-2,3-dimethylphenyl)-1-deuterio-2,3-dimethylbenzo[f]isoquinolin-3-ium (PubChem CID 159812092) has the molecular formula C28H30N+ and a molecular weight of 381.56 g/mol. Its IUPAC name is 4-(5-cyclopentyl-2,3-dimethylphenyl)-1-deuterio-2,3-dimethylbenzo[f]isoquinolin-3-ium.
| Compound Name | 4-(5-cyclopentyl-2,3-dimethylphenyl)-1-deuterio-2,3-dimethylbenzo[f]isoquinolin-3-ium |
|---|---|
| PubChem CID | 159812092 |
| Molecular Formula | C28H30N+ |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-(5-cyclopentyl-2,3-dimethylphenyl)-1-deuterio-2,3-dimethylbenzo[f]isoquinolin-3-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C3CCCC3)cc(C)c2C)c2ccc3ccccc3c12 |
| InChI | InChI=1S/C28H30N/c1-18-15-23(21-9-5-6-10-21)17-26(20(18)3)28-25-14-13-22-11-7-8-12-24(22)27(25)16-19(2)29(28)4/h7-8,11-17,21H,5-6,9-10H2,1-4H3/q+1/i16D |
| InChIKey | XTSFBIPWAQKZTD-QNLPYAOMSA-N |
| XLogP | 7.07 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|