C28H29F3N+ — CID 160553551
4-(5-tert-butyl-2,3-dimethylphenyl)-1-deuterio-2,3-dimethyl-9-(trifluoromethyl)benzo[f]isoquinolin-3-ium (PubChem CID 160553551) has the molecular formula C28H29F3N+ and a molecular weight of 437.55 g/mol. Its IUPAC name is 4-(5-tert-butyl-2,3-dimethylphenyl)-1-deuterio-2,3-dimethyl-9-(trifluoromethyl)benzo[f]isoquinolin-3-ium.
| Compound Name | 4-(5-tert-butyl-2,3-dimethylphenyl)-1-deuterio-2,3-dimethyl-9-(trifluoromethyl)benzo[f]isoquinolin-3-ium |
|---|---|
| PubChem CID | 160553551 |
| Molecular Formula | C28H29F3N+ |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 4-(5-tert-butyl-2,3-dimethylphenyl)-1-deuterio-2,3-dimethyl-9-(trifluoromethyl)benzo[f]isoquinolin-3-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C(C)(C)C)cc(C)c2C)c2ccc3ccc(C(F)(F)F)cc3c12 |
| InChI | InChI=1S/C28H29F3N/c1-16-12-21(27(4,5)6)15-23(18(16)3)26-22-11-9-19-8-10-20(28(29,30)31)14-24(19)25(22)13-17(2)32(26)7/h8-15H,1-7H3/q+1/i13D |
| InChIKey | QHJZNIRYQNSNIE-YSOHJTORSA-N |
| XLogP | 7.73 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|