C28H31N2+ — CID 158666797
1-(5-tert-butyl-2,3-dimethylphenyl)-4-deuterio-2,3-dimethyl-6-pyridin-3-ylisoquinolin-2-ium (PubChem CID 158666797) has the molecular formula C28H31N2+ and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-(5-tert-butyl-2,3-dimethylphenyl)-4-deuterio-2,3-dimethyl-6-pyridin-3-ylisoquinolin-2-ium.
| Compound Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-4-deuterio-2,3-dimethyl-6-pyridin-3-ylisoquinolin-2-ium |
|---|---|
| PubChem CID | 158666797 |
| Molecular Formula | C28H31N2+ |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-4-deuterio-2,3-dimethyl-6-pyridin-3-ylisoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C(C)(C)C)cc(C)c2C)c2ccc(-c3cccnc3)cc12 |
| InChI | InChI=1S/C28H31N2/c1-18-13-24(28(4,5)6)16-26(20(18)3)27-25-11-10-21(22-9-8-12-29-17-22)15-23(25)14-19(2)30(27)7/h8-17H,1-7H3/q+1/i14D |
| InChIKey | CTKUTLUYPLLAQW-FCFVPJCTSA-N |
| XLogP | 6.62 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|